C21H23F2N3OS — CID 162689523
3-(difluoromethyl)-1-methyl-N-[5-(3-methylbutoxy)naphthalen-1-yl]pyrazole-4-carbothioamide (PubChem CID 162689523) has the molecular formula C21H23F2N3OS and a molecular weight of 403.50 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-methyl-N-[5-(3-methylbutoxy)naphthalen-1-yl]pyrazole-4-carbothioamide.
| Compound Name | 3-(difluoromethyl)-1-methyl-N-[5-(3-methylbutoxy)naphthalen-1-yl]pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 162689523 |
| Molecular Formula | C21H23F2N3OS |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3-(difluoromethyl)-1-methyl-N-[5-(3-methylbutoxy)naphthalen-1-yl]pyrazole-4-carbothioamide |
| SMILES | CC(C)CCOc1cccc2c(NC(=S)c3cn(C)nc3C(F)F)cccc12 |
| InChI | InChI=1S/C21H23F2N3OS/c1-13(2)10-11-27-18-9-5-6-14-15(18)7-4-8-17(14)24-21(28)16-12-26(3)25-19(16)20(22)23/h4-9,12-13,20H,10-11H2,1-3H3,(H,24,28) |
| InChIKey | FXIIJIQHOPYMEE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|