C8H16O4S — CID 19756005
O-(1-propan-2-yloxyethyl) 2,3-dihydroxypropanethioate (PubChem CID 19756005) has the molecular formula C8H16O4S and a molecular weight of 208.28 g/mol. Its IUPAC name is O-(1-propan-2-yloxyethyl) 2,3-dihydroxypropanethioate.
| Compound Name | O-(1-propan-2-yloxyethyl) 2,3-dihydroxypropanethioate |
|---|---|
| PubChem CID | 19756005 |
| Molecular Formula | C8H16O4S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | O-(1-propan-2-yloxyethyl) 2,3-dihydroxypropanethioate |
| SMILES | CC(C)OC(C)OC(=S)C(O)CO |
| InChI | InChI=1S/C8H16O4S/c1-5(2)11-6(3)12-8(13)7(10)4-9/h5-7,9-10H,4H2,1-3H3 |
| InChIKey | NWAXOCDVYACBFP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|