About (Z)-4-oxopent-2-en-2-olate;propanedioate
(Z)-4-oxopent-2-en-2-olate;propanedioate (PubChem CID 19760714) has the molecular formula C8H9O6-3
and a molecular weight of 201.15 g/mol. Its IUPAC name is (Z)-4-oxopent-2-en-2-olate;propanedioate.
Molecular Properties
| Compound Name | (Z)-4-oxopent-2-en-2-olate;propanedioate |
| PubChem CID | 19760714 |
| Molecular Formula | C8H9O6-3 |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | (Z)-4-oxopent-2-en-2-olate;propanedioate |
| SMILES | CC(=O)/C=C(/C)[O-].O=C([O-])CC(=O)[O-] |
| InChI | InChI=1S/C5H8O2.C3H4O4/c1-4(6)3-5(2)7;4-2(5)1-3(6)7/h3,6H,1-2H3;1H2,(H,4,5)(H,6,7)/p-3/b4-3-; |
| InChIKey | WNIRMIQGVDOFEE-LNKPDPKZSA-K |
| XLogP | -3.28 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-oxopent-2-en-2-olate;propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-oxopent-2-en-2-olate;propanedioate?
The IUPAC name of (Z)-4-oxopent-2-en-2-olate;propanedioate (CID 19760714) is (Z)-4-oxopent-2-en-2-olate;propanedioate.
What is the SMILES notation for (Z)-4-oxopent-2-en-2-olate;propanedioate?
The canonical SMILES for (Z)-4-oxopent-2-en-2-olate;propanedioate is CC(=O)/C=C(/C)[O-].O=C([O-])CC(=O)[O-].
What is the InChIKey of (Z)-4-oxopent-2-en-2-olate;propanedioate?
The InChIKey is WNIRMIQGVDOFEE-LNKPDPKZSA-K. The full InChI is InChI=1S/C5H8O2.C3H4O4/c1-4(6)3-5(2)7;4-2(5)1-3(6)7/h3,6H,1-2H3;1H2,(H,4,5)(H,6,7)/p-3/b4-3-;.
What are the key properties of (Z)-4-oxopent-2-en-2-olate;propanedioate?
(Z)-4-oxopent-2-en-2-olate;propanedioate has a molecular weight of 201.15 g/mol, XLogP of -3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-oxopent-2-en-2-olate;propanedioate is sourced from PubChem (CID 19760714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).