C11H17NO2 — CID 19761791
2-[(2,5-dimethylpyrrol-1-yl)methyl]butanoic acid (PubChem CID 19761791) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-[(2,5-dimethylpyrrol-1-yl)methyl]butanoic acid.
| Compound Name | 2-[(2,5-dimethylpyrrol-1-yl)methyl]butanoic acid |
|---|---|
| PubChem CID | 19761791 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-[(2,5-dimethylpyrrol-1-yl)methyl]butanoic acid |
| SMILES | CCC(Cn1c(C)ccc1C)C(=O)O |
| InChI | InChI=1S/C11H17NO2/c1-4-10(11(13)14)7-12-8(2)5-6-9(12)3/h5-6,10H,4,7H2,1-3H3,(H,13,14) |
| InChIKey | FHTOTJDKWNTGPY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |