C10H11NO2 — CID 19764293
2-ethyl-3a,7a-dihydroisoindole-1,3-dione (PubChem CID 19764293) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-ethyl-3a,7a-dihydroisoindole-1,3-dione.
| Compound Name | 2-ethyl-3a,7a-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 19764293 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2-ethyl-3a,7a-dihydroisoindole-1,3-dione |
| SMILES | CCN1C(=O)C2C=CC=CC2C1=O |
| InChI | InChI=1S/C10H11NO2/c1-2-11-9(12)7-5-3-4-6-8(7)10(11)13/h3-8H,2H2,1H3 |
| InChIKey | BZPYXSVSIJYTAM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|