C14H16F3NO2 — CID 58920460
2-(1,1,1-trifluoro-4-methylpentan-2-yl)-3a,7a-dihydroisoindole-1,3-dione (PubChem CID 58920460) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-(1,1,1-trifluoro-4-methylpentan-2-yl)-3a,7a-dihydroisoindole-1,3-dione.
| Compound Name | 2-(1,1,1-trifluoro-4-methylpentan-2-yl)-3a,7a-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 58920460 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-(1,1,1-trifluoro-4-methylpentan-2-yl)-3a,7a-dihydroisoindole-1,3-dione |
| SMILES | CC(C)CC(N1C(=O)C2C=CC=CC2C1=O)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2/c1-8(2)7-11(14(15,16)17)18-12(19)9-5-3-4-6-10(9)13(18)20/h3-6,8-11H,7H2,1-2H3 |
| InChIKey | OQURMUPFDYLYFR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|