C9H9F2NO — CID 18956378
3,3-difluoro-1-methyl-3a,7a-dihydroindol-2-one (PubChem CID 18956378) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is 3,3-difluoro-1-methyl-3a,7a-dihydroindol-2-one.
| Compound Name | 3,3-difluoro-1-methyl-3a,7a-dihydroindol-2-one |
|---|---|
| PubChem CID | 18956378 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3,3-difluoro-1-methyl-3a,7a-dihydroindol-2-one |
| SMILES | CN1C(=O)C(F)(F)C2C=CC=CC21 |
| InChI | InChI=1S/C9H9F2NO/c1-12-7-5-3-2-4-6(7)9(10,11)8(12)13/h2-7H,1H3 |
| InChIKey | HAHTTZHGFXPNPD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |