C10H11F2NO2 — CID 141185855
3,3-difluoro-1-(methoxymethyl)-3a,4-dihydroindol-2-one (PubChem CID 141185855) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 3,3-difluoro-1-(methoxymethyl)-3a,4-dihydroindol-2-one.
| Compound Name | 3,3-difluoro-1-(methoxymethyl)-3a,4-dihydroindol-2-one |
|---|---|
| PubChem CID | 141185855 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3,3-difluoro-1-(methoxymethyl)-3a,4-dihydroindol-2-one |
| SMILES | COCN1C(=O)C(F)(F)C2CC=CC=C21 |
| InChI | InChI=1S/C10H11F2NO2/c1-15-6-13-8-5-3-2-4-7(8)10(11,12)9(13)14/h2-3,5,7H,4,6H2,1H3 |
| InChIKey | BVQGTAZGWYWOHF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |