About 2-ethylhexylaluminum(2+) diphenoxide
2-ethylhexylaluminum(2+) diphenoxide (PubChem CID 19766079) has the molecular formula C20H27AlO2
and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-ethylhexylaluminum(2+) diphenoxide.
Molecular Properties
| Compound Name | 2-ethylhexylaluminum(2+) diphenoxide |
| PubChem CID | 19766079 |
| Molecular Formula | C20H27AlO2 |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2-ethylhexylaluminum(2+) diphenoxide |
| SMILES | CCCCC(CC)C[Al+2].[O-]c1ccccc1.[O-]c1ccccc1 |
| InChI | InChI=1S/C8H17.2C6H6O.Al/c1-4-6-7-8(3)5-2;2*7-6-4-2-1-3-5-6;/h8H,3-7H2,1-2H3;2*1-5,7H;/q;;;+2/p-2 |
| InChIKey | VZTNEMZGXMLVOP-UHFFFAOYSA-L |
| XLogP | 4.31 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylhexylaluminum(2+) diphenoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexylaluminum(2+) diphenoxide?
The IUPAC name of 2-ethylhexylaluminum(2+) diphenoxide (CID 19766079) is 2-ethylhexylaluminum(2+) diphenoxide.
What is the SMILES notation for 2-ethylhexylaluminum(2+) diphenoxide?
The canonical SMILES for 2-ethylhexylaluminum(2+) diphenoxide is CCCCC(CC)C[Al+2].[O-]c1ccccc1.[O-]c1ccccc1.
What is the InChIKey of 2-ethylhexylaluminum(2+) diphenoxide?
The InChIKey is VZTNEMZGXMLVOP-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H17.2C6H6O.Al/c1-4-6-7-8(3)5-2;2*7-6-4-2-1-3-5-6;/h8H,3-7H2,1-2H3;2*1-5,7H;/q;;;+2/p-2.
What are the key properties of 2-ethylhexylaluminum(2+) diphenoxide?
2-ethylhexylaluminum(2+) diphenoxide has a molecular weight of 326.42 g/mol, XLogP of 4.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexylaluminum(2+) diphenoxide is sourced from PubChem (CID 19766079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).