C13H13NO2 — CID 19766822
(Z)-3-cyano-3-(3,4,5-trimethylphenyl)prop-2-enoic acid (PubChem CID 19766822) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (Z)-3-cyano-3-(3,4,5-trimethylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-cyano-3-(3,4,5-trimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 19766822 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (Z)-3-cyano-3-(3,4,5-trimethylphenyl)prop-2-enoic acid |
| SMILES | Cc1cc(/C(C#N)=C/C(=O)O)cc(C)c1C |
| InChI | InChI=1S/C13H13NO2/c1-8-4-11(5-9(2)10(8)3)12(7-14)6-13(15)16/h4-6H,1-3H3,(H,15,16)/b12-6+ |
| InChIKey | PWWFRARTFJCVLN-WUXMJOGZSA-N |
| XLogP | 2.60 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_cyano_E(1)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|