C14H11N3O2 — CID 71337414
3-[(2,2-dicyano-1-phenylethenyl)amino]but-2-enoic acid (PubChem CID 71337414) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-[(2,2-dicyano-1-phenylethenyl)amino]but-2-enoic acid.
| Compound Name | 3-[(2,2-dicyano-1-phenylethenyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 71337414 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-[(2,2-dicyano-1-phenylethenyl)amino]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)NC(=C(C#N)C#N)c1ccccc1 |
| InChI | InChI=1S/C14H11N3O2/c1-10(7-13(18)19)17-14(12(8-15)9-16)11-5-3-2-4-6-11/h2-7,17H,1H3,(H,18,19) |
| InChIKey | AVPJUDRCFDUHHV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|