C20H28I3N3O9 — CID 19767252
5-[acetyl-(2-hydroxy-3-methoxypropyl)amino]-1-N,3-N-bis(1,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide (PubChem CID 19767252) has the molecular formula C20H28I3N3O9 and a molecular weight of 835.17 g/mol. Its IUPAC name is 5-[acetyl-(2-hydroxy-3-methoxypropyl)amino]-1-N,3-N-bis(1,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide.
| Compound Name | 5-[acetyl-(2-hydroxy-3-methoxypropyl)amino]-1-N,3-N-bis(1,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19767252 |
| Molecular Formula | C20H28I3N3O9 |
| Molecular Weight | 835.17 g/mol |
| Exact Mass | 834.90 |
| IUPAC Name | 5-[acetyl-(2-hydroxy-3-methoxypropyl)amino]-1-N,3-N-bis(1,3-dihydroxypropyl)-2,4,6-triiodobenzene-1,3-dicarboxamide |
| SMILES | COCC(O)CN(C(C)=O)c1c(I)c(C(=O)NC(O)CCO)c(I)c(C(=O)NC(O)CCO)c1I |
| InChI | InChI=1S/C20H28I3N3O9/c1-9(29)26(7-10(30)8-35-2)18-16(22)13(19(33)24-11(31)3-5-27)15(21)14(17(18)23)20(34)25-12(32)4-6-28/h10-12,27-28,30-32H,3-8H2,1-2H3,(H,24,33)(H,25,34) |
| InChIKey | UGPSAMXKIJUABV-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 188.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.17 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|