C25H24F2N2O — CID 19771949
[4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidin-1-yl]-phenylmethanone (PubChem CID 19771949) has the molecular formula C25H24F2N2O and a molecular weight of 406.48 g/mol. Its IUPAC name is [4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidin-1-yl]-phenylmethanone.
| Compound Name | [4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 19771949 |
| Molecular Formula | C25H24F2N2O |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCC(C(Nc2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H24F2N2O/c26-21-8-6-18(7-9-21)24(28-23-12-10-22(27)11-13-23)19-14-16-29(17-15-19)25(30)20-4-2-1-3-5-20/h1-13,19,24,28H,14-17H2 |
| InChIKey | QDWPVAPOCUFUCT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |