C19H22F2N4 — CID 19772106
4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidine-1-carboximidamide (PubChem CID 19772106) has the molecular formula C19H22F2N4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidine-1-carboximidamide.
| Compound Name | 4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 19772106 |
| Molecular Formula | C19H22F2N4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-[(4-fluoroanilino)-(4-fluorophenyl)methyl]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC(C(Nc2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H22F2N4/c20-15-3-1-13(2-4-15)18(24-17-7-5-16(21)6-8-17)14-9-11-25(12-10-14)19(22)23/h1-8,14,18,24H,9-12H2,(H3,22,23) |
| InChIKey | XUTOXJGUZHPWQA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|