C19H23ClN4O3 — CID 19773562
ethyl 4-[2-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]ethoxy]benzoate (PubChem CID 19773562) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is ethyl 4-[2-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]ethoxy]benzoate.
| Compound Name | ethyl 4-[2-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]ethoxy]benzoate |
|---|---|
| PubChem CID | 19773562 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | ethyl 4-[2-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]ethoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCCN2CCN(c3ccc(Cl)nn3)CC2)cc1 |
| InChI | InChI=1S/C19H23ClN4O3/c1-2-26-19(25)15-3-5-16(6-4-15)27-14-13-23-9-11-24(12-10-23)18-8-7-17(20)21-22-18/h3-8H,2,9-14H2,1H3 |
| InChIKey | KUPYZEITNWGELC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |