C12H28NO4+ — CID 19774837
3-hydroxypropyl-[1-[2-(2-methoxyethoxy)ethoxy]ethyl]-dimethylazanium (PubChem CID 19774837) has the molecular formula C12H28NO4+ and a molecular weight of 250.36 g/mol. Its IUPAC name is 3-hydroxypropyl-[1-[2-(2-methoxyethoxy)ethoxy]ethyl]-dimethylazanium.
| Compound Name | 3-hydroxypropyl-[1-[2-(2-methoxyethoxy)ethoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 19774837 |
| Molecular Formula | C12H28NO4+ |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 3-hydroxypropyl-[1-[2-(2-methoxyethoxy)ethoxy]ethyl]-dimethylazanium |
| SMILES | COCCOCCOC(C)[N+](C)(C)CCCO |
| InChI | InChI=1S/C12H28NO4/c1-12(13(2,3)6-5-7-14)17-11-10-16-9-8-15-4/h12,14H,5-11H2,1-4H3/q+1 |
| InChIKey | BKAOMGAXFKBQIM-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|