C24H49OP — CID 19774877
2,2,4-trimethyl-6-phosphoroso-6-(2,4,4-trimethylpentyl)tridecane (PubChem CID 19774877) has the molecular formula C24H49OP and a molecular weight of 384.63 g/mol. Its IUPAC name is 2,2,4-trimethyl-6-phosphoroso-6-(2,4,4-trimethylpentyl)tridecane.
| Compound Name | 2,2,4-trimethyl-6-phosphoroso-6-(2,4,4-trimethylpentyl)tridecane |
|---|---|
| PubChem CID | 19774877 |
| Molecular Formula | C24H49OP |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.35 |
| IUPAC Name | 2,2,4-trimethyl-6-phosphoroso-6-(2,4,4-trimethylpentyl)tridecane |
| SMILES | CCCCCCCC(CC(C)CC(C)(C)C)(CC(C)CC(C)(C)C)P=O |
| InChI | InChI=1S/C24H49OP/c1-10-11-12-13-14-15-24(26-25,18-20(2)16-22(4,5)6)19-21(3)17-23(7,8)9/h20-21H,10-19H2,1-9H3 |
| InChIKey | ADNCSASEOLVIPP-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|