C19H39OP — CID 19826656
5-(2,3-dimethylbutyl)-2,3-dimethyl-5-phosphorosoundecane (PubChem CID 19826656) has the molecular formula C19H39OP and a molecular weight of 314.49 g/mol. Its IUPAC name is 5-(2,3-dimethylbutyl)-2,3-dimethyl-5-phosphorosoundecane.
| Compound Name | 5-(2,3-dimethylbutyl)-2,3-dimethyl-5-phosphorosoundecane |
|---|---|
| PubChem CID | 19826656 |
| Molecular Formula | C19H39OP |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | 5-(2,3-dimethylbutyl)-2,3-dimethyl-5-phosphorosoundecane |
| SMILES | CCCCCCC(CC(C)C(C)C)(CC(C)C(C)C)P=O |
| InChI | InChI=1S/C19H39OP/c1-8-9-10-11-12-19(21-20,13-17(6)15(2)3)14-18(7)16(4)5/h15-18H,8-14H2,1-7H3 |
| InChIKey | LCIQUYVJIXQJIK-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|