About 2,6,10-trimethylpentadecane
2,6,10-trimethylpentadecane (PubChem CID 19775) has the molecular formula C18H38
and a molecular weight of 254.50 g/mol. Its IUPAC name is 2,6,10-trimethylpentadecane.
Molecular Properties
| Compound Name | 2,6,10-trimethylpentadecane |
| PubChem CID | 19775 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | 2,6,10-trimethylpentadecane |
| SMILES | CCCCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C18H38/c1-6-7-8-12-17(4)14-10-15-18(5)13-9-11-16(2)3/h16-18H,6-15H2,1-5H3 |
| InChIKey | LBWPYRZGHYVSEL-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,6,10-trimethylpentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6,10-trimethylpentadecane?
The IUPAC name of 2,6,10-trimethylpentadecane (CID 19775) is 2,6,10-trimethylpentadecane.
What is the SMILES notation for 2,6,10-trimethylpentadecane?
The canonical SMILES for 2,6,10-trimethylpentadecane is CCCCCC(C)CCCC(C)CCCC(C)C.
What is the InChIKey of 2,6,10-trimethylpentadecane?
The InChIKey is LBWPYRZGHYVSEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38/c1-6-7-8-12-17(4)14-10-15-18(5)13-9-11-16(2)3/h16-18H,6-15H2,1-5H3.
What are the key properties of 2,6,10-trimethylpentadecane?
2,6,10-trimethylpentadecane has a molecular weight of 254.50 g/mol, XLogP of 6.84, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6,10-trimethylpentadecane is sourced from PubChem (CID 19775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).