C31H27N3O5S — CID 19780418
benzyl N-[3-[[5-[(2-methylphenyl)sulfonylcarbamoyl]indol-1-yl]methyl]phenyl]carbamate (PubChem CID 19780418) has the molecular formula C31H27N3O5S and a molecular weight of 553.64 g/mol. Its IUPAC name is benzyl N-[3-[[5-[(2-methylphenyl)sulfonylcarbamoyl]indol-1-yl]methyl]phenyl]carbamate.
| Compound Name | benzyl N-[3-[[5-[(2-methylphenyl)sulfonylcarbamoyl]indol-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 19780418 |
| Molecular Formula | C31H27N3O5S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | benzyl N-[3-[[5-[(2-methylphenyl)sulfonylcarbamoyl]indol-1-yl]methyl]phenyl]carbamate |
| SMILES | Cc1ccccc1S(=O)(=O)NC(=O)c1ccc2c(ccn2Cc2cccc(NC(=O)OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C31H27N3O5S/c1-22-8-5-6-13-29(22)40(37,38)33-30(35)26-14-15-28-25(19-26)16-17-34(28)20-24-11-7-12-27(18-24)32-31(36)39-21-23-9-3-2-4-10-23/h2-19H,20-21H2,1H3,(H,32,36)(H,33,35) |
| InChIKey | LYCYRUMEGCRWBR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |