C7H16N2 — CID 19782034
N,N-di(propan-2-yl)methanimidamide (PubChem CID 19782034) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is N,N-di(propan-2-yl)methanimidamide.
| Compound Name | N,N-di(propan-2-yl)methanimidamide |
|---|---|
| PubChem CID | 19782034 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | N,N-di(propan-2-yl)methanimidamide |
| SMILES | [H]/N=C/N(C(C)C)C(C)C |
| InChI | InChI=1S/C7H16N2/c1-6(2)9(5-8)7(3)4/h5-8H,1-4H3/b8-5+ |
| InChIKey | ZQRAQDIQRXIIGH-VMPITWQZSA-N |
| XLogP | 1.71 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|