C14H20N6O2 — CID 19785291
ethyl 4-[(9-methylpurin-8-yl)amino]piperidine-1-carboxylate (PubChem CID 19785291) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethyl 4-[(9-methylpurin-8-yl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(9-methylpurin-8-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 19785291 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | ethyl 4-[(9-methylpurin-8-yl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2nc3cncnc3n2C)CC1 |
| InChI | InChI=1S/C14H20N6O2/c1-3-22-14(21)20-6-4-10(5-7-20)17-13-18-11-8-15-9-16-12(11)19(13)2/h8-10H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | VLDDQPGUSOLFLV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |