C9H20N5O+ — CID 19785393
2-[4-(2-aminoethyl)morpholin-4-ium-4-yl]-4,5-dihydroimidazol-1-amine (PubChem CID 19785393) has the molecular formula C9H20N5O+ and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)morpholin-4-ium-4-yl]-4,5-dihydroimidazol-1-amine.
| Compound Name | 2-[4-(2-aminoethyl)morpholin-4-ium-4-yl]-4,5-dihydroimidazol-1-amine |
|---|---|
| PubChem CID | 19785393 |
| Molecular Formula | C9H20N5O+ |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-[4-(2-aminoethyl)morpholin-4-ium-4-yl]-4,5-dihydroimidazol-1-amine |
| SMILES | NCC[N+]1(C2=NCCN2N)CCOCC1 |
| InChI | InChI=1S/C9H20N5O/c10-1-4-14(5-7-15-8-6-14)9-12-2-3-13(9)11/h1-8,10-11H2/q+1 |
| InChIKey | PULYXWWJPWRTLE-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|