C17H15ClN2O3S — CID 19787175
(2-chlorophenyl)-[2-[[(E)-2-nitroethenyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methanone (PubChem CID 19787175) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is (2-chlorophenyl)-[2-[[(E)-2-nitroethenyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methanone.
| Compound Name | (2-chlorophenyl)-[2-[[(E)-2-nitroethenyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methanone |
|---|---|
| PubChem CID | 19787175 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (2-chlorophenyl)-[2-[[(E)-2-nitroethenyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methanone |
| SMILES | O=C(c1ccccc1Cl)c1c(N/C=C/[N+](=O)[O-])sc2c1CCCC2 |
| InChI | InChI=1S/C17H15ClN2O3S/c18-13-7-3-1-5-11(13)16(21)15-12-6-2-4-8-14(12)24-17(15)19-9-10-20(22)23/h1,3,5,7,9-10,19H,2,4,6,8H2/b10-9+ |
| InChIKey | VBJYRJOWWQXMSX-MDZDMXLPSA-N |
| XLogP | 4.67 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|