C3H2N2O3S — CID 19798290
4-nitro-3H-1,3-oxazole-2-thione (PubChem CID 19798290) has the molecular formula C3H2N2O3S and a molecular weight of 146.13 g/mol. Its IUPAC name is 4-nitro-3H-1,3-oxazole-2-thione.
| Compound Name | 4-nitro-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 19798290 |
| Molecular Formula | C3H2N2O3S |
| Molecular Weight | 146.13 g/mol |
| Exact Mass | 145.98 |
| IUPAC Name | 4-nitro-3H-1,3-oxazole-2-thione |
| SMILES | O=[N+]([O-])c1coc(=S)[nH]1 |
| InChI | InChI=1S/C3H2N2O3S/c6-5(7)2-1-8-3(9)4-2/h1H,(H,4,9) |
| InChIKey | AZXDBFWQMGWFGG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.13 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|