C26H31N7O — CID 19799553
N,5-dibutyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrazole-3-carboxamide (PubChem CID 19799553) has the molecular formula C26H31N7O and a molecular weight of 457.58 g/mol. Its IUPAC name is N,5-dibutyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrazole-3-carboxamide.
| Compound Name | N,5-dibutyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19799553 |
| Molecular Formula | C26H31N7O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | N,5-dibutyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrazole-3-carboxamide |
| SMILES | CCCCNC(=O)c1cc(CCCC)n(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)n1 |
| InChI | InChI=1S/C26H31N7O/c1-3-5-9-21-17-24(26(34)27-16-6-4-2)30-33(21)18-19-12-14-20(15-13-19)22-10-7-8-11-23(22)25-28-31-32-29-25/h7-8,10-15,17H,3-6,9,16,18H2,1-2H3,(H,27,34)(H,28,29,31,32) |
| InChIKey | HWXGMDUDQOUFTA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|