C26H32N8O — CID 67917661
N-butyl-1-(2,2-dimethylpropyl)-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carboxamide (PubChem CID 67917661) has the molecular formula C26H32N8O and a molecular weight of 472.60 g/mol. Its IUPAC name is N-butyl-1-(2,2-dimethylpropyl)-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | N-butyl-1-(2,2-dimethylpropyl)-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 67917661 |
| Molecular Formula | C26H32N8O |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | N-butyl-1-(2,2-dimethylpropyl)-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carboxamide |
| SMILES | CCCCNC(=O)c1nc(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)n(CC(C)(C)C)n1 |
| InChI | InChI=1S/C26H32N8O/c1-5-6-15-27-25(35)24-28-22(34(31-24)17-26(2,3)4)16-18-11-13-19(14-12-18)20-9-7-8-10-21(20)23-29-32-33-30-23/h7-14H,5-6,15-17H2,1-4H3,(H,27,35)(H,29,30,32,33) |
| InChIKey | MNCXYAUQTOOXDH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|