C10H7NO5 — CID 19800639
2-methyl-1,3-benzoxazole-4,5-dicarboxylic acid (PubChem CID 19800639) has the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. Its IUPAC name is 2-methyl-1,3-benzoxazole-4,5-dicarboxylic acid.
| Compound Name | 2-methyl-1,3-benzoxazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 19800639 |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2-methyl-1,3-benzoxazole-4,5-dicarboxylic acid |
| SMILES | Cc1nc2c(C(=O)O)c(C(=O)O)ccc2o1 |
| InChI | InChI=1S/C10H7NO5/c1-4-11-8-6(16-4)3-2-5(9(12)13)7(8)10(14)15/h2-3H,1H3,(H,12,13)(H,14,15) |
| InChIKey | FPWASLQBOHZEIZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |