C11H17N3 — CID 19805268
4-diazo-N,N-diethyl-5-methylcyclohexa-1,5-dien-1-amine (PubChem CID 19805268) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 4-diazo-N,N-diethyl-5-methylcyclohexa-1,5-dien-1-amine.
| Compound Name | 4-diazo-N,N-diethyl-5-methylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 19805268 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 4-diazo-N,N-diethyl-5-methylcyclohexa-1,5-dien-1-amine |
| SMILES | CCN(CC)C1=CCC(=[N+]=[N-])C(C)=C1 |
| InChI | InChI=1S/C11H17N3/c1-4-14(5-2)10-6-7-11(13-12)9(3)8-10/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | NBQLKAYSIHPXHS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 39.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|