C12H13N3 — CID 19807464
3-(1,2,3,6-tetrahydropyridin-6-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 19807464) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 3-(1,2,3,6-tetrahydropyridin-6-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(1,2,3,6-tetrahydropyridin-6-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 19807464 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 3-(1,2,3,6-tetrahydropyridin-6-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C1=CC(c2c[nH]c3ncccc23)NCC1 |
| InChI | InChI=1S/C12H13N3/c1-2-6-13-11(5-1)10-8-15-12-9(10)4-3-7-14-12/h1,3-5,7-8,11,13H,2,6H2,(H,14,15) |
| InChIKey | XGVCNCNTSKOHDK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|