C30H29NOP+ — CID 19808921
[4-(3-cyanobutoxy)phenyl]methyl-triphenylphosphanium (PubChem CID 19808921) has the molecular formula C30H29NOP+ and a molecular weight of 450.54 g/mol. Its IUPAC name is [4-(3-cyanobutoxy)phenyl]methyl-triphenylphosphanium.
| Compound Name | [4-(3-cyanobutoxy)phenyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 19808921 |
| Molecular Formula | C30H29NOP+ |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [4-(3-cyanobutoxy)phenyl]methyl-triphenylphosphanium |
| SMILES | CC(C#N)CCOc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H29NOP/c1-25(23-31)21-22-32-27-19-17-26(18-20-27)24-33(28-11-5-2-6-12-28,29-13-7-3-8-14-29)30-15-9-4-10-16-30/h2-20,25H,21-22,24H2,1H3/q+1 |
| InChIKey | AWUHPGPGAROEDG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|