C18H30O2Si — CID 19809769
2,4,4-trimethyl-3-[(1Z)-3-methyl-1-trimethylsilyloxypenta-1,4-dienyl]cyclohex-2-en-1-one (PubChem CID 19809769) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-[(1Z)-3-methyl-1-trimethylsilyloxypenta-1,4-dienyl]cyclohex-2-en-1-one.
| Compound Name | 2,4,4-trimethyl-3-[(1Z)-3-methyl-1-trimethylsilyloxypenta-1,4-dienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 19809769 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2,4,4-trimethyl-3-[(1Z)-3-methyl-1-trimethylsilyloxypenta-1,4-dienyl]cyclohex-2-en-1-one |
| SMILES | C=CC(C)/C=C(\O[Si](C)(C)C)C1=C(C)C(=O)CCC1(C)C |
| InChI | InChI=1S/C18H30O2Si/c1-9-13(2)12-16(20-21(6,7)8)17-14(3)15(19)10-11-18(17,4)5/h9,12-13H,1,10-11H2,2-8H3/b16-12- |
| InChIKey | OVQCNNGFUHBILB-VBKFSLOCSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|