C22H18N2O4 — CID 19812645
2,2-diisocyanato-5,5-dimethyl-4,4-diphenylcyclohexane-1,3-dione (PubChem CID 19812645) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2,2-diisocyanato-5,5-dimethyl-4,4-diphenylcyclohexane-1,3-dione.
| Compound Name | 2,2-diisocyanato-5,5-dimethyl-4,4-diphenylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 19812645 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2,2-diisocyanato-5,5-dimethyl-4,4-diphenylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(N=C=O)(N=C=O)C(=O)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O4/c1-20(2)13-18(27)22(23-14-25,24-15-26)19(28)21(20,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12H,13H2,1-2H3 |
| InChIKey | VEGNWJCHWXWKOQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|