C64H45F3O9S2 — CID 19813742
trifluoromethanesulfonate;tris[4-[2-(9H-fluoren-1-yl)acetyl]oxyphenyl]sulfanium (PubChem CID 19813742) has the molecular formula C64H45F3O9S2 and a molecular weight of 1079.18 g/mol. Its IUPAC name is trifluoromethanesulfonate;tris[4-[2-(9H-fluoren-1-yl)acetyl]oxyphenyl]sulfanium.
| Compound Name | trifluoromethanesulfonate;tris[4-[2-(9H-fluoren-1-yl)acetyl]oxyphenyl]sulfanium |
|---|---|
| PubChem CID | 19813742 |
| Molecular Formula | C64H45F3O9S2 |
| Molecular Weight | 1079.18 g/mol |
| Exact Mass | 1078.25 |
| IUPAC Name | trifluoromethanesulfonate;tris[4-[2-(9H-fluoren-1-yl)acetyl]oxyphenyl]sulfanium |
| SMILES | O=C(Cc1cccc2c1Cc1ccccc1-2)Oc1ccc([S+](c2ccc(OC(=O)Cc3cccc4c3Cc3ccccc3-4)cc2)c2ccc(OC(=O)Cc3cccc4c3Cc3ccccc3-4)cc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C63H45O6S.CHF3O3S/c64-61(37-43-13-7-19-55-52-16-4-1-10-40(52)34-58(43)55)67-46-22-28-49(29-23-46)70(50-30-24-47(25-31-50)68-62(65)38-44-14-8-20-56-53-17-5-2-11-41(53)35-59(44)56)51-32-26-48(27-33-51)69-63(66)39-45-15-9-21-57-54-18-6-3-12-42(54)36-60(45)57;2-1(3,4)8(5,6)7/h1-33H,34-39H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | WSKGNLZSQVYXHU-UHFFFAOYSA-M |
| XLogP | 12.99 |
| TPSA | 136.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.18 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|