C38H25F9O5S2 — CID 139785764
[4-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy(diphenyl)-λ4-sulfanyl]phenyl] 2-phenanthren-9-ylacetate (PubChem CID 139785764) has the molecular formula C38H25F9O5S2 and a molecular weight of 796.73 g/mol. Its IUPAC name is [4-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy(diphenyl)-λ4-sulfanyl]phenyl] 2-phenanthren-9-ylacetate.
| Compound Name | [4-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy(diphenyl)-λ4-sulfanyl]phenyl] 2-phenanthren-9-ylacetate |
|---|---|
| PubChem CID | 139785764 |
| Molecular Formula | C38H25F9O5S2 |
| Molecular Weight | 796.73 g/mol |
| Exact Mass | 796.10 |
| IUPAC Name | [4-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy(diphenyl)-λ4-sulfanyl]phenyl] 2-phenanthren-9-ylacetate |
| SMILES | O=C(Cc1cc2ccccc2c2ccccc12)Oc1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H25F9O5S2/c39-35(40,37(43,44)45)36(41,42)38(46,47)54(49,50)52-53(28-12-3-1-4-13-28,29-14-5-2-6-15-29)30-21-19-27(20-22-30)51-34(48)24-26-23-25-11-7-8-16-31(25)33-18-10-9-17-32(26)33/h1-23H,24H2 |
| InChIKey | HOKJLPWZSSROMK-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.73 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|