C66H40F7O11S2+ — CID 87321866
[9,9-bis[4-(4-fluorobenzoyl)oxyphenyl]fluoren-2-yl]-bis[4-(4-fluorobenzoyl)oxyphenyl]sulfanium;trifluoromethanesulfonic acid (PubChem CID 87321866) has the molecular formula C66H40F7O11S2+ and a molecular weight of 1206.15 g/mol. Its IUPAC name is [9,9-bis[4-(4-fluorobenzoyl)oxyphenyl]fluoren-2-yl]-bis[4-(4-fluorobenzoyl)oxyphenyl]sulfanium;trifluoromethanesulfonic acid.
| Compound Name | [9,9-bis[4-(4-fluorobenzoyl)oxyphenyl]fluoren-2-yl]-bis[4-(4-fluorobenzoyl)oxyphenyl]sulfanium;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 87321866 |
| Molecular Formula | C66H40F7O11S2+ |
| Molecular Weight | 1206.15 g/mol |
| Exact Mass | 1205.19 |
| IUPAC Name | [9,9-bis[4-(4-fluorobenzoyl)oxyphenyl]fluoren-2-yl]-bis[4-(4-fluorobenzoyl)oxyphenyl]sulfanium;trifluoromethanesulfonic acid |
| SMILES | O=C(Oc1ccc([S+](c2ccc(OC(=O)c3ccc(F)cc3)cc2)c2ccc3c(c2)C(c2ccc(OC(=O)c4ccc(F)cc4)cc2)(c2ccc(OC(=O)c4ccc(F)cc4)cc2)c2ccccc2-3)cc1)c1ccc(F)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C65H39F4O8S.CHF3O3S/c66-46-17-5-40(6-18-46)61(70)74-50-25-13-44(14-26-50)65(45-15-27-51(28-16-45)75-62(71)41-7-19-47(67)20-8-41)59-4-2-1-3-57(59)58-38-37-56(39-60(58)65)78(54-33-29-52(30-34-54)76-63(72)42-9-21-48(68)22-10-42)55-35-31-53(32-36-55)77-64(73)43-11-23-49(69)24-12-43;2-1(3,4)8(5,6)7/h1-39H;(H,5,6,7)/q+1; |
| InChIKey | CHFYMMGGBIHLDS-UHFFFAOYSA-N |
| XLogP | 14.97 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1206.15 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|