C28H41N3O3S — CID 19813916
3-[[4-(decylamino)benzoyl]amino]-4-methoxy-N-(2-methylsulfanylethyl)benzamide (PubChem CID 19813916) has the molecular formula C28H41N3O3S and a molecular weight of 499.72 g/mol. Its IUPAC name is 3-[[4-(decylamino)benzoyl]amino]-4-methoxy-N-(2-methylsulfanylethyl)benzamide.
| Compound Name | 3-[[4-(decylamino)benzoyl]amino]-4-methoxy-N-(2-methylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 19813916 |
| Molecular Formula | C28H41N3O3S |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 3-[[4-(decylamino)benzoyl]amino]-4-methoxy-N-(2-methylsulfanylethyl)benzamide |
| SMILES | CCCCCCCCCCNc1ccc(C(=O)Nc2cc(C(=O)NCCSC)ccc2OC)cc1 |
| InChI | InChI=1S/C28H41N3O3S/c1-4-5-6-7-8-9-10-11-18-29-24-15-12-22(13-16-24)28(33)31-25-21-23(14-17-26(25)34-2)27(32)30-19-20-35-3/h12-17,21,29H,4-11,18-20H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | MZWDTNUNKXARGK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|