C23H22N4O2S2 — CID 19817097
3-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 19817097) has the molecular formula C23H22N4O2S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 3-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 19817097 |
| Molecular Formula | C23H22N4O2S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 3-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1CCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C23H22N4O2S2/c28-31(29)21-10-4-6-17-5-3-8-19(22(17)21)27(31)16-13-25-11-14-26(15-12-25)23-18-7-1-2-9-20(18)30-24-23/h1-10H,11-16H2 |
| InChIKey | XMUGQAVTDVQMCA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |