About N'-ethylpropanehydrazide
N'-ethylpropanehydrazide (PubChem CID 19821575) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is N'-ethylpropanehydrazide.
Molecular Properties
| Compound Name | N'-ethylpropanehydrazide |
| PubChem CID | 19821575 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | N'-ethylpropanehydrazide |
| SMILES | CCNNC(=O)CC |
| InChI | InChI=1S/C5H12N2O/c1-3-5(8)7-6-4-2/h6H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | NQUUVCNFMOESGT-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethylpropanehydrazide?
The IUPAC name of N'-ethylpropanehydrazide (CID 19821575) is N'-ethylpropanehydrazide.
What is the SMILES notation for N'-ethylpropanehydrazide?
The canonical SMILES for N'-ethylpropanehydrazide is CCNNC(=O)CC.
What is the InChIKey of N'-ethylpropanehydrazide?
The InChIKey is NQUUVCNFMOESGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-3-5(8)7-6-4-2/h6H,3-4H2,1-2H3,(H,7,8).
What are the key properties of N'-ethylpropanehydrazide?
N'-ethylpropanehydrazide has a molecular weight of 116.16 g/mol, XLogP of 0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethylpropanehydrazide is sourced from PubChem (CID 19821575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).