C16H11Br3OS — CID 19824639
(E)-1-(4-methylsulfanylphenyl)-3-(2,3,4-tribromophenyl)prop-2-en-1-one (PubChem CID 19824639) has the molecular formula C16H11Br3OS and a molecular weight of 491.04 g/mol. Its IUPAC name is (E)-1-(4-methylsulfanylphenyl)-3-(2,3,4-tribromophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-methylsulfanylphenyl)-3-(2,3,4-tribromophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19824639 |
| Molecular Formula | C16H11Br3OS |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 487.81 |
| IUPAC Name | (E)-1-(4-methylsulfanylphenyl)-3-(2,3,4-tribromophenyl)prop-2-en-1-one |
| SMILES | CSc1ccc(C(=O)/C=C/c2ccc(Br)c(Br)c2Br)cc1 |
| InChI | InChI=1S/C16H11Br3OS/c1-21-12-6-2-10(3-7-12)14(20)9-5-11-4-8-13(17)16(19)15(11)18/h2-9H,1H3/b9-5+ |
| InChIKey | NHWBWPUBRHOIRH-WEVVVXLNSA-N |
| XLogP | 6.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|