C24H26N4O3 — CID 19824998
8-(3-morpholin-4-ylpropoxy)-2-pyridin-2-yl-5,6-dihydrobenzo[h]cinnolin-3-one (PubChem CID 19824998) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 8-(3-morpholin-4-ylpropoxy)-2-pyridin-2-yl-5,6-dihydrobenzo[h]cinnolin-3-one.
| Compound Name | 8-(3-morpholin-4-ylpropoxy)-2-pyridin-2-yl-5,6-dihydrobenzo[h]cinnolin-3-one |
|---|---|
| PubChem CID | 19824998 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 8-(3-morpholin-4-ylpropoxy)-2-pyridin-2-yl-5,6-dihydrobenzo[h]cinnolin-3-one |
| SMILES | O=c1cc2c(nn1-c1ccccn1)-c1ccc(OCCCN3CCOCC3)cc1CC2 |
| InChI | InChI=1S/C24H26N4O3/c29-23-17-19-6-5-18-16-20(31-13-3-10-27-11-14-30-15-12-27)7-8-21(18)24(19)26-28(23)22-4-1-2-9-25-22/h1-2,4,7-9,16-17H,3,5-6,10-15H2 |
| InChIKey | PKIIQAGCHQQVOW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|