C29H32N2O4S — CID 59770363
N-[3-[(E)-[6-(2-morpholin-4-ylethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]phenyl]methanesulfonamide (PubChem CID 59770363) has the molecular formula C29H32N2O4S and a molecular weight of 504.65 g/mol. Its IUPAC name is N-[3-[(E)-[6-(2-morpholin-4-ylethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(E)-[6-(2-morpholin-4-ylethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59770363 |
| Molecular Formula | C29H32N2O4S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | N-[3-[(E)-[6-(2-morpholin-4-ylethoxy)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(/C=C2\c3ccccc3CCc3cc(OCCN4CCOCC4)ccc32)c1 |
| InChI | InChI=1S/C29H32N2O4S/c1-36(32,33)30-25-7-4-5-22(19-25)20-29-27-8-3-2-6-23(27)9-10-24-21-26(11-12-28(24)29)35-18-15-31-13-16-34-17-14-31/h2-8,11-12,19-21,30H,9-10,13-18H2,1H3/b29-20+ |
| InChIKey | RHYVHNIVXMOBJO-ZTKZIYFRSA-N |
| XLogP | 4.46 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|