C24H21F2NO2S — CID 72556957
N-[3-[[7-(difluoromethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]phenyl]methanesulfonamide (PubChem CID 72556957) has the molecular formula C24H21F2NO2S and a molecular weight of 425.50 g/mol. Its IUPAC name is N-[3-[[7-(difluoromethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[[7-(difluoromethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 72556957 |
| Molecular Formula | C24H21F2NO2S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-[3-[[7-(difluoromethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(C=C2c3ccccc3CCc3c2cccc3C(F)F)c1 |
| InChI | InChI=1S/C24H21F2NO2S/c1-30(28,29)27-18-8-4-6-16(14-18)15-23-19-9-3-2-7-17(19)12-13-21-20(23)10-5-11-22(21)24(25)26/h2-11,14-15,24,27H,12-13H2,1H3 |
| InChIKey | MUYYIRXQMZHQLD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|