C22H18ClNO3S — CID 59769912
N-[3-[(E)-(7-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)methyl]phenyl]methanesulfonamide (PubChem CID 59769912) has the molecular formula C22H18ClNO3S and a molecular weight of 411.91 g/mol. Its IUPAC name is N-[3-[(E)-(7-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(E)-(7-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59769912 |
| Molecular Formula | C22H18ClNO3S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N-[3-[(E)-(7-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(/C=C2/c3ccccc3OCc3c(Cl)cccc32)c1 |
| InChI | InChI=1S/C22H18ClNO3S/c1-28(25,26)24-16-7-4-6-15(12-16)13-19-17-9-5-10-21(23)20(17)14-27-22-11-3-2-8-18(19)22/h2-13,24H,14H2,1H3/b19-13+ |
| InChIKey | OAVKQZCQDGEHCI-CPNJWEJPSA-N |
| XLogP | 5.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|