C24H21NO2S — CID 59770156
N-[3-[[(2R,4S)-11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylidene]methyl]phenyl]methanesulfonamide (PubChem CID 59770156) has the molecular formula C24H21NO2S and a molecular weight of 387.50 g/mol. Its IUPAC name is N-[3-[[(2R,4S)-11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylidene]methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[[(2R,4S)-11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylidene]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59770156 |
| Molecular Formula | C24H21NO2S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[3-[[(2R,4S)-11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylidene]methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(/C=C2\c3ccccc3[C@H]3C[C@H]3c3ccccc32)c1 |
| InChI | InChI=1S/C24H21NO2S/c1-28(26,27)25-17-8-6-7-16(13-17)14-22-18-9-2-4-11-20(18)23-15-24(23)21-12-5-3-10-19(21)22/h2-14,23-25H,15H2,1H3/b22-14-/t23-,24+/m0/s1 |
| InChIKey | JXAPLNLODKDALA-NFSPBSMJSA-N |
| XLogP | 5.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|