C23H20FNO4S — CID 59770066
N-[3-[(E)-(3-fluoro-8-methoxy-6H-benzo[c][1]benzoxepin-11-ylidene)methyl]phenyl]methanesulfonamide (PubChem CID 59770066) has the molecular formula C23H20FNO4S and a molecular weight of 425.48 g/mol. Its IUPAC name is N-[3-[(E)-(3-fluoro-8-methoxy-6H-benzo[c][1]benzoxepin-11-ylidene)methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(E)-(3-fluoro-8-methoxy-6H-benzo[c][1]benzoxepin-11-ylidene)methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59770066 |
| Molecular Formula | C23H20FNO4S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-[3-[(E)-(3-fluoro-8-methoxy-6H-benzo[c][1]benzoxepin-11-ylidene)methyl]phenyl]methanesulfonamide |
| SMILES | COc1ccc2c(c1)COc1cc(F)ccc1/C2=C/c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H20FNO4S/c1-28-19-7-9-20-16(12-19)14-29-23-13-17(24)6-8-21(23)22(20)11-15-4-3-5-18(10-15)25-30(2,26)27/h3-13,25H,14H2,1-2H3/b22-11+ |
| InChIKey | GXAZFESDPMGVDR-SSDVNMTOSA-N |
| XLogP | 4.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|