C25H23NO4S — CID 59770086
methyl (2Z)-2-[[3-(methanesulfonamido)phenyl]methylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-6-carboxylate (PubChem CID 59770086) has the molecular formula C25H23NO4S and a molecular weight of 433.53 g/mol. Its IUPAC name is methyl (2Z)-2-[[3-(methanesulfonamido)phenyl]methylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-6-carboxylate.
| Compound Name | methyl (2Z)-2-[[3-(methanesulfonamido)phenyl]methylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-6-carboxylate |
|---|---|
| PubChem CID | 59770086 |
| Molecular Formula | C25H23NO4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | methyl (2Z)-2-[[3-(methanesulfonamido)phenyl]methylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCc1ccccc1/C2=C/c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C25H23NO4S/c1-30-25(27)20-12-13-23-19(16-20)11-10-18-7-3-4-9-22(18)24(23)15-17-6-5-8-21(14-17)26-31(2,28)29/h3-9,12-16,26H,10-11H2,1-2H3/b24-15- |
| InChIKey | VPPOCYJMAMWBBQ-IWIPYMOSSA-N |
| XLogP | 4.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|