C22H19ClN2O2S — CID 76837851
N-[3-[(13-chloro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)methyl]phenyl]methanesulfonamide (PubChem CID 76837851) has the molecular formula C22H19ClN2O2S and a molecular weight of 410.93 g/mol. Its IUPAC name is N-[3-[(13-chloro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(13-chloro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 76837851 |
| Molecular Formula | C22H19ClN2O2S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[3-[(13-chloro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(C=C2c3ccc(Cl)cc3CCc3ncccc32)c1 |
| InChI | InChI=1S/C22H19ClN2O2S/c1-28(26,27)25-18-5-2-4-15(12-18)13-21-19-9-8-17(23)14-16(19)7-10-22-20(21)6-3-11-24-22/h2-6,8-9,11-14,25H,7,10H2,1H3 |
| InChIKey | HMFZVAPIHDDLRM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|