C28H21Cl2NO2S — CID 59770556
4-chloro-N-[3-[(Z)-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)methyl]phenyl]benzenesulfonamide (PubChem CID 59770556) has the molecular formula C28H21Cl2NO2S and a molecular weight of 506.45 g/mol. Its IUPAC name is 4-chloro-N-[3-[(Z)-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)methyl]phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-[(Z)-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59770556 |
| Molecular Formula | C28H21Cl2NO2S |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 4-chloro-N-[3-[(Z)-(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)methyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(/C=C2/c3ccccc3CCc3cc(Cl)ccc32)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H21Cl2NO2S/c29-22-10-13-25(14-11-22)34(32,33)31-24-6-3-4-19(16-24)17-28-26-7-2-1-5-20(26)8-9-21-18-23(30)12-15-27(21)28/h1-7,10-18,31H,8-9H2/b28-17- |
| InChIKey | YPJNUSVHBVDUAY-QRQIAZFYSA-N |
| XLogP | 7.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|