C26H38O8 — CID 19825390
1-(2-hydroperoxypropan-2-yl)-4-[2-[2-[2-[[4-(2-hydroperoxypropan-2-yl)phenyl]methoxy]ethoxy]ethoxy]ethoxymethyl]benzene (PubChem CID 19825390) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is 1-(2-hydroperoxypropan-2-yl)-4-[2-[2-[2-[[4-(2-hydroperoxypropan-2-yl)phenyl]methoxy]ethoxy]ethoxy]ethoxymethyl]benzene.
| Compound Name | 1-(2-hydroperoxypropan-2-yl)-4-[2-[2-[2-[[4-(2-hydroperoxypropan-2-yl)phenyl]methoxy]ethoxy]ethoxy]ethoxymethyl]benzene |
|---|---|
| PubChem CID | 19825390 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 1-(2-hydroperoxypropan-2-yl)-4-[2-[2-[2-[[4-(2-hydroperoxypropan-2-yl)phenyl]methoxy]ethoxy]ethoxy]ethoxymethyl]benzene |
| SMILES | CC(C)(OO)c1ccc(COCCOCCOCCOCc2ccc(C(C)(C)OO)cc2)cc1 |
| InChI | InChI=1S/C26H38O8/c1-25(2,33-27)23-9-5-21(6-10-23)19-31-17-15-29-13-14-30-16-18-32-20-22-7-11-24(12-8-22)26(3,4)34-28/h5-12,27-28H,13-20H2,1-4H3 |
| InChIKey | FZDASGQXJUNDQS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|